| Catalog |
DS1415732 |
| CAS |
1415-73-2 |
| Structure |  |
| Synonyms |
Barbaloin; Aloin A; Barbaloin A; Aloinum |
| IUPAC Name |
(10S)-1,8-dihydroxy-3-(hydroxymethyl)-10-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-10H-anthracen-9-one |
| Molecular Weight |
418.394 |
| Molecular Formula |
C21H22O9 |
| InChI |
InChI=1S/C21H22O9/c22-6-8-4-10-14(21-20(29)19(28)17(26)13(7-23)30-21)9-2-1-3-11(24)15(9)18(27)16(10)12(25)5-8/h1-5,13-14,17,19-26,28-29H,6-7H2/t13-,14+,17-,19+,20-,21+/m1/s1 |
| InChI Key |
AFHJQYHRLPMKHU-OSYMLPPYSA-N |
| Melting Point |
148 °C |
| Density |
1.303 g/cm3 |
| Appearance |
Brown powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
215-808-0 |
| Isomeric SMILES |
C1=CC2=C(C(=C1)O)C(=O)C3=C([C@H]2[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C=C(C=C3O)CO |
| Packaging |
25 kg |
| Specification |
20%, 40%, 90% |
Our products and services are for research use only and cannot be used for any clinical purposes.
