| Catalog |
DS63968649 |
| CAS |
63968-64-9 |
| Structure |  |
| Synonyms |
Arteannuin; Artemisinine |
| IUPAC Name |
(1R,4S,5R,8S,9R,12S,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| Molecular Weight |
282.33 |
| Molecular Formula |
C15H22O5 |
| InChI |
InChI=1S/C15H22O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-11,13H,4-7H2,1-3H3/t8-,9-,10+,11+,13-,14-,15-/m1/s1 |
| InChI Key |
BLUAFEHZUWYNDE-NNWCWBAJSA-N |
| Melting Point |
156-157 °C |
| Purity |
98%+ |
| Density |
1.098 g/cm3 |
| Solubility |
Soluble to 100 mM in DMSO and to 75 mM in ethanol |
| Appearance |
White to off-white crystalline solid. |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
700-290-5 |
| Isomeric SMILES |
C[C@@H]1CC[C@H]2[C@H](C(=O)O[C@H]3[C@@]24[C@H]1CC[C@](O3)(OO4)C)C |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
