| Catalog |
DS13312522 |
| CAS |
13312-52-2 |
| Structure |  |
| Synonyms |
9-Cis-Beta-Carotene; 9-Cis-Beta,Beta-Carotene; (9Z)-Beta-Carotene |
| IUPAC Name |
1,3,3-Trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E,15Z,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethylcyclohexen-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaenyl]cyclohexene |
| Molecular Weight |
536.87 |
| Molecular Formula |
C40H56 |
| InChI |
InChI=1S/C40H56/c1-31(19-13-21-33(3)25-27-37-35(5)23-15-29-39(37,7)8)17-11-12-18-32(2)20-14-22-34(4)26-28-38-36(6)24-16-30-40(38,9)10/h11-14,17-22,25-28H,15-16,23-24,29-30H2,1-10H3/b12-11+,19-13+,20-14+,27-25+,28-26+,31-17+,32-18+,33-21-,34-22+ |
| InChI Key |
OENHQHLEOONYIE-BVZAMQQESA-N |
| Appearance |
Orange red powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| Isomeric SMILES |
CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(/C)\C=C\C2=C(CCCC2(C)C)C)/C)/C |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
