| Catalog |
DS473983 |
| CAS |
473-98-3 |
| Structure |  |
| Synonyms |
Betulinol; Betuline; Trochol; Betulol; Lup-20(29)-Ene-3b,28-Diol; Betulinic Alcohol |
| IUPAC Name |
(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-ol |
| Molecular Weight |
442.72 |
| Molecular Formula |
C30H50O2 |
| InChI |
InChI=1S/C30H50O2/c1-19(2)20-10-15-30(18-31)17-16-28(6)21(25(20)30)8-9-23-27(5)13-12-24(32)26(3,4)22(27)11-14-29(23,28)7/h20-25,31-32H,1,8-18H2,2-7H3/t20-,21+,22-,23+,24-,25+,27-,28+,29+,30+/m0/s1 |
| InChI Key |
FVWJYYTZTCVBKE-ROUWMTJPSA-N |
| Melting Point |
256-257 °C |
| Purity |
98%+ |
| Density |
0.988 g/cm3 |
| Solubility |
Slightly soluble in chloroform, methanol |
| Appearance |
White crystal powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
207-475-5 |
| Isomeric SMILES |
CC(=C)[C@@H]1CC[C@]2([C@H]1[C@H]3CC[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O)C)CO |
| Packaging |
1/5/10/25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
