| Catalog |
DS299285 |
| CAS |
299-28-5 |
| Structure |  |
| Synonyms |
Calcium D-Gluconate; Calglucon; Gluconate Calcium |
| IUPAC Name |
Calcium;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| Molecular Weight |
430.37 |
| Molecular Formula |
C12H22CaO14 |
| InChI |
InChI=1S/2C6H12O7.Ca/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChI Key |
NEEHYRZPVYRGPP-IYEMJOQQSA-L |
| Melting Point |
195 °C |
| Purity |
99%+ |
| Appearance |
White crystalline granule or powder |
| Storage |
Store in a tightly sealed container under an inert atmosphere. Keep in a cool dry place away from light. |
| Heavy Metal |
10 ppm maximum |
| Isomeric SMILES |
C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Ca+2] |
| Mineral Content |
Ca (as-is): 9.0% |
Our products and services are for research use only and cannot be used for any clinical purposes.
