| Catalog |
DS465429 |
| CAS |
465-42-9 |
| Structure |  |
| Synonyms |
All-Trans-Capsanthin; Capsanthin/Capsorubin; (3R,3'S,5'R)-3,3'-Dihydroxy-Beta,Kappa-Caroten-6'-One; CHEBI:3375; 420NY1J57N; (2E,4E,6E,8E,10E,12E,14E,16E,18E)-19-[(4R)-4-Hydroxy-2,6,6-Trimethylcyclohexen-1-Yl]-1-[(1R,4S)-4-Hydroxy-1,2,2-Trimethylcyclopentyl]-4,8,13,17-Tetramethylnonadeca-2,4,6,8,10,12,14,16,18-Nonaen-1-One |
| IUPAC Name |
(2E,4E,6E,8E,10E,12E,14E,16E,18E)-19-[(4R)-4-hydroxy-2,6,6-trimethylcyclohexen-1-yl]-1-[(1R,4S)-4-hydroxy-1,2,2-trimethylcyclopentyl]-4,8,13,17-tetramethylnonadeca-2,4,6,8,10,12,14,16,18-nonaen-1-one |
| Molecular Weight |
584.87 |
| Molecular Formula |
C40H56O3 |
| InChI |
InChI=1S/C40H56O3/c1-29(17-13-19-31(3)21-23-36-33(5)25-34(41)26-38(36,6)7)15-11-12-16-30(2)18-14-20-32(4)22-24-37(43)40(10)28-35(42)27-39(40,8)9/h11-24,34-35,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+/t34-,35+,40+/m1/s1 |
| InChI Key |
VYIRVAXUEZSDNC-RDJLEWNRSA-N |
| Melting Point |
177-178 °C |
| Density |
1.012 g/cm3 |
| Solubility |
Slightly soluble in chloroform, DMSO, ethyl acetate |
| Appearance |
Dark red to very dark brown solid |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
207-364-1 |
| Isomeric SMILES |
CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C(=O)[C@@]2(C[C@H](CC2(C)C)O)C)/C)/C |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
