| Catalog |
DS3650097 |
| CAS |
3650-09-7 |
| Structure |  |
| Synonyms |
Salvin; Carnosicacid; LI791SXT24; CHEBI:65585; 11,12-Dihydroxyabieta-8,11,13-Trien-20-Oic Acid |
| IUPAC Name |
(4aR,10aS)-5,6-dihydroxy-1,1-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-4a-carboxylic acid |
| Molecular Weight |
332.43 |
| Molecular Formula |
C20H28O4 |
| InChI |
InChI=1S/C20H28O4/c1-11(2)13-10-12-6-7-14-19(3,4)8-5-9-20(14,18(23)24)15(12)17(22)16(13)21/h10-11,14,21-22H,5-9H2,1-4H3,(H,23,24)/t14-,20+/m0/s1 |
| InChI Key |
QRYRORQUOLYVBU-VBKZILBWSA-N |
| Melting Point |
190 °C |
| Purity |
5%-90% |
| Density |
1.184±0.06 g/cm3 |
| Solubility |
Slightly soluble in methanol, chloroform |
| Appearance |
Wellow powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
609-253-7 |
| Isomeric SMILES |
CC(C)C1=C(C(=C2C(=C1)CC[C@@H]3[C@@]2(CCCC3(C)C)C(=O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
