| Catalog |
DS481492 |
| CAS |
481-49-2 |
| Structure |  |
| Synonyms |
(+)-Cepharanthine; O-Methylcepharanoline; Cepharantin; Cepharanthine [JAN]; 6',12'-Dimethoxy-2,2'-Dimethyl-6,7-(Methylenebis(Oxy))Oxyacanthan |
| IUPAC Name |
(14S,27R)-22,33-dimethoxy-13,28-dimethyl-2,5,7,20-tetraoxa-13,28-diazaoctacyclo[25.6.2.216,19.13,10.121,25.04,8.031,35.014,39]nonatriaconta-1(33),3(39),4(8),9,16(38),17,19(37),21,23,25(36),31,34-dodecaene |
| Molecular Weight |
606.71 |
| Molecular Formula |
C37H38N5O6 |
| InChI |
InChI=1S/C37H38N2O6/c1-38-13-11-24-18-31(41-4)33-20-27(24)28(38)16-23-7-10-30(40-3)32(17-23)44-26-8-5-22(6-9-26)15-29-35-25(12-14-39(29)2)19-34-36(37(35)45-33)43-21-42-34/h5-10,17-20,28-29H,11-16,21H2,1-4H3/t28-,29+/m1/s1 |
| InChI Key |
YVPXVXANRNDGTA-WDYNHAJCSA-N |
| Melting Point |
145-155 °C |
| Purity |
95%+ |
| Density |
1.176 g/cm3 |
| Solubility |
Soluble in DMSO (35 mg/mL) or ethanol (20 mg/mL) |
| Appearance |
Off-white powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
228-085-1 |
| Isomeric SMILES |
CN1CCC2=CC3=C(C4=C2[C@@H]1CC5=CC=C(C=C5)OC6=C(C=CC(=C6)C[C@@H]7C8=CC(=C(C=C8CCN7C)OC)O4)OC)OCO3 |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
