| Catalog |
DS481743 |
| CAS |
481-74-3 |
| Structure |  |
| Synonyms |
1,8-Dihydroxy-3-Methylanthraquinone; 3-Methylchrysazi |
| IUPAC Name |
1,8-Dihydroxy-3-methylanthracene-9,10-dione |
| Molecular Weight |
254.23 |
| Molecular Formula |
C15H10O4 |
| InChI |
InChI=1S/C15H10O4/c1-7-5-9-13(11(17)6-7)15(19)12-8(14(9)18)3-2-4-10(12)16/h2-6,16-17H,1H3 |
| InChI Key |
LQGUBLBATBMXHT-UHFFFAOYSA-N |
| Melting Point |
194-198 °C |
| Purity |
98%+ |
| Density |
1.269 g/cm3 |
| Solubility |
Almost insoluble in water, slightly soluble in cold alcohol, easily soluble in boiling ethanol, soluble in benzene. |
| Appearance |
Hexagonal or monoclinic crystal |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
207-572-2 |
| Isomeric SMILES |
CC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=CC=C3O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
