| Catalog |
DS527093 |
| CAS |
527-09-3 |
| Structure |  |
| Synonyms |
D-Gluconic Acid Copper(II) Salt |
| IUPAC Name |
Copper;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| Molecular Weight |
453.85 |
| Molecular Formula |
Cu(C6H11O7)2 |
| InChI |
InChI=1S/2C6H12O7.Cu/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChI Key |
OCUCCJIRFHNWBP-IYEMJOQQSA-L |
| Melting Point |
155-157 °C |
| Solubility |
Slightly soluble in aqueous acid |
| Appearance |
Blue-green powder |
| Storage |
Store in a clean, dry warehouse in the original unopened containers. |
| Assay |
98.0%-102.0% |
| EC Number |
208-408-2 |
| Isomeric SMILES |
C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Cu+2] |
| Lead |
1 ppm maximum |
| Mineral Content |
Fe (as-is): 13.7%-14.3% |
| Packaging |
25 kg |
| Standard |
USP, GB |
Our products and services are for research use only and cannot be used for any clinical purposes.
