| Catalog |
DS73030 |
| CAS |
73-03-0 |
| Structure |  |
| Synonyms |
Cordycepine; 9-Cordyceposidoadenine; 9-(Beta-D-3'-Deoxyribofuranosyl)Adenine |
| IUPAC Name |
(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol |
| Molecular Weight |
251.24 |
| Molecular Formula |
C10H13N5O3 |
| InChI |
InChI=1S/C10H13N5O3/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(17)1-5(2-16)18-10/h3-6,10,16-17H,1-2H2,(H2,11,12,13)/t5-,6+,10+/m0/s1 |
| InChI Key |
OFEZSBMBBKLLBJ-BAJZRUMYSA-N |
| Melting Point |
225-229 °C |
| Purity |
50%+ |
| Density |
1.294 g/cm3 |
| Solubility |
Soluble in water |
| Appearance |
Brown powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
200-791-4 |
| Isomeric SMILES |
C1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C(N=CN=C32)N)CO |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
