| Catalog |
DS4547244 |
| CAS |
4547-24-4 |
| Structure |  |
| Synonyms |
Glucosol; Colosic Acid; Corosolic-Acid; 2-Alpha-Hydroxyursolic Acid |
| IUPAC Name |
(1S,2R,4aS,6aR,6aS,6bR,8aR,10R,11R,12aR,14bS)-10,11-dihydroxy-1,2,6a,6b,9,9,12a-heptamethyl-2,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydro-1H-picene-4a-carboxylic acid |
| Molecular Weight |
472.7 |
| Molecular Formula |
C30H48O4 |
| InChI |
InChI=1S/C30H48O4/c1-17-10-13-30(25(33)34)15-14-28(6)19(23(30)18(17)2)8-9-22-27(5)16-20(31)24(32)26(3,4)21(27)11-12-29(22,28)7/h8,17-18,20-24,31-32H,9-16H2,1-7H3,(H,33,34)/t17-,18+,20-,21+,22-,23+,24+,27+,28-,29-,30+/m1/s1 |
| InChI Key |
HFGSQOYIOKBQOW-ZSDYHTTISA-N |
| Melting Point |
243-245 °C |
| Purity |
98%+ |
| Density |
1.14±0.1 g/cm3 |
| Solubility |
Methanol: 1 mg/mL, clear, colorless |
| Appearance |
White amorphous powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
610-253-4 |
| Isomeric SMILES |
C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(C[C@H]([C@@H](C5(C)C)O)O)C)C)[C@@H]2[C@H]1C)C)C(=O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
