| Catalog |
DS458377 |
| CAS |
458-37-7 |
| Structure |  |
| Synonyms |
Diferuloylmethane; Natural Yellow 3; Indian Saffron; Kacha Haldi; Curcuma; Gelbwurz |
| IUPAC Name |
(1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |
| Molecular Weight |
368.38 |
| Molecular Formula |
C21H20O6 |
| InChI |
InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ |
| InChI Key |
VFLDPWHFBUODDF-FCXRPNKRSA-N |
| Melting Point |
183 °C |
| Purity |
95%+ |
| Density |
0.930 g/cm3 |
| Solubility |
Ethanol: 10 mg/mL |
| Appearance |
Ginger yellow powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
207-280-5 |
| Isomeric SMILES |
COC1=C(C=CC(=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)O)OC)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
