| Catalog |
DS78574944 |
| CAS |
78574-94-4 |
| Structure |  |
| Synonyms |
Astramembrangenin; Cyclogalegenol; Cyclosiversigenin; Cyclogalegigenin; X37D9F2L0V; Cyclosieversigenin |
| IUPAC Name |
(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-15-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-7,7,12,16-tetramethylpentacyclo[9.7.0.01,3.03,8.012,16]octadecane-6,9,14-triol |
| Molecular Weight |
490.71 |
| Molecular Formula |
C30H50O5 |
| InChI |
InChI=1S/C30H50O5/c1-24(2)20(33)8-11-30-16-29(30)13-12-26(5)23(28(7)10-9-21(35-28)25(3,4)34)18(32)15-27(26,6)19(29)14-17(31)22(24)30/h17-23,31-34H,8-16H2,1-7H3/t17-,18-,19-,20-,21-,22-,23-,26+,27-,28+,29-,30+/m0/s1 |
| InChI Key |
WENNXORDXYGDTP-UOUCMYEWSA-N |
| Melting Point |
241-245 °C |
| Purity |
98%+ |
| Density |
1.20±0.1 g/cm3 |
| Appearance |
White to almost white powder to crystal |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| Isomeric SMILES |
C[C@]12CC[C@@]34C[C@@]35CC[C@@H](C([C@@H]5[C@H](C[C@H]4[C@@]1(C[C@@H]([C@@H]2[C@]6(CC[C@H](O6)C(C)(C)O)C)O)C)O)(C)C)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
