| Catalog |
DS76822214 |
| CAS |
76822-21-4 |
| Structure |  |
| Synonyms |
Salvianic Acid A; (R)-3-(3,4-Dihydroxyphenyl)-2-Hydroxypropanoic Acid; Dan Shen Suan A; (2R)-3-(3,4-Dihydroxyphenyl)-2-Hydroxypropanoic Acid |
| IUPAC Name |
(2R)-3-(3,4-dihydroxyphenyl)-2-hydroxypropanoic acid |
| Molecular Weight |
198.17 |
| Molecular Formula |
C9H10O5 |
| InChI |
InChI=1S/C9H10O5/c10-6-2-1-5(3-7(6)11)4-8(12)9(13)14/h1-3,8,10-12H,4H2,(H,13,14)/t8-/m1/s1 |
| InChI Key |
PAFLSMZLRSPALU-MRVPVSSYSA-N |
| Melting Point |
255-258 °C |
| Purity |
98%+ |
| Density |
1.546 g/cm3 |
| Solubility |
Slightly soluble in water |
| Appearance |
White crystal |
| Shelf Life |
24 months |
| Storage |
Store at 2-8 ºC in a dry, airtight container away from light. Under an inert atmosphere. |
| Isomeric SMILES |
C1=CC(=C(C=C1C[C@H](C(=O)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
