| Catalog |
DS528483 |
| CAS |
528-48-3 |
| Structure |  |
| Synonyms |
Sodium Aescinate; Natural Brown 1; Fisetin; 3,3,4,7-Tetrahydroxyflavone; 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-4H-chromen-4-one |
| IUPAC Name |
2-(3,4-dihydroxyphenyl)-3,7-dihydroxychromen-4-one |
| Molecular Weight |
286.23 |
| Molecular Formula |
C15H10O6 |
| InChI |
InChI=1S/C15H10O6/c16-8-2-3-9-12(6-8)21-15(14(20)13(9)19)7-1-4-10(17)11(18)5-7/h1-6,16-18,20H |
| InChI Key |
XHEFDIBZLJXQHF-UHFFFAOYSA-N |
| Melting Point |
>330 °C |
| Purity |
98%+ |
| Density |
1.298 g/cm3 |
| Solubility |
Slightly soluble in methanol, DMSO |
| Appearance |
Light yellow powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
208-434-4 |
| Isomeric SMILES |
C1=CC(=C(C=C1C2=C(C(=O)C3=C(O2)C=C(C=C3)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
