| Catalog |
DS485723 |
| CAS |
485-72-3 |
| Structure |  |
| Synonyms |
Biochanin B; Formononetol; 7-Hydroxy-3-(4-Methoxyphenyl)-4H-Chromen-4-One; 7-Hydroxy-4'-Methoxyisoflavone |
| IUPAC Name |
7-Hydroxy-3-(4-methoxyphenyl)chromen-4-one |
| Molecular Weight |
268.26 |
| Molecular Formula |
C16H12O4 |
| InChI |
InChI=1S/C16H12O4/c1-19-12-5-2-10(3-6-12)14-9-20-15-8-11(17)4-7-13(15)16(14)18/h2-9,17H,1H3 |
| InChI Key |
HKQYGTCOTHHOMP-UHFFFAOYSA-N |
| Melting Point |
256-260 °C |
| Purity |
98%+ |
| Density |
1.1529 g/cm3 |
| Solubility |
Easily soluble in methanol, ethyl acetate, ether, hardly soluble in water |
| Appearance |
White to light beige powder |
| Shelf Life |
24 months |
| Storage |
Store at 2-8 ºC in a dry, airtight container away from light. Under an inert atmosphere. |
| EC Number |
207-623-9 |
| Isomeric SMILES |
COC1=CC=C(C=C1)C2=COC3=C(C2=O)C=CC(=C3)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
