| Catalog |
DS110178 |
| CAS |
110-17-8 |
| Structure |  |
| Synonyms |
Trans-Butenedioic Acid; Fumarate; Allomaleic Acid; Lichenic Acid; Boletic Acid; 2-Butenedioic Acid |
| IUPAC Name |
(E)-but-2-enedioic acid |
| Molecular Weight |
116.07 |
| Molecular Formula |
C4H4O4 |
| InChI |
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ |
| InChI Key |
VZCYOOQTPOCHFL-OWOJBTEDSA-N |
| Melting Point |
298-300 °C |
| Density |
1.62 g/cm3 |
| Solubility |
95% Ethanol: 0.46g/10 mL, clear, colorless |
| Appearance |
White fine crystalline powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container away from light |
| Certification |
ISO, Kosher,Halal, HACCP |
| EC Number |
203-743-0 |
| Isomeric SMILES |
C(=C/C(=O)O)\C(=O)O |
Our products and services are for research use only and cannot be used for any clinical purposes.
