| Catalog |
DS84929271 |
| CAS |
84929-27-1 |
| Synonyms |
(2R,3S,4S)-2-(3,4-Dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-Dihydroxyphenyl)-3,7-Dihydroxy-3,5-Dimethyl-2,4-Dihydrochromen-8-Yl]-3,4-Dihydro-2H-Chromene-3,5,7-Triol; Grape Seed P.E. |
| IUPAC Name |
(2R,3S,4S)-2-(3,4-dihydroxyphenyl)-4-[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,5-dimethyl-2,4-dihydrochromen-8-yl]-3,4-dihydro-2H-chromene-3,5,7-triol |
| Molecular Weight |
590.574 |
| Molecular Formula |
C32H30O11 |
| InChI |
InChI=1S/C32H30O11/c1-13-7-22(38)26(30-17(13)12-32(2,41)31(43-30)15-4-6-19(35)21(37)9-15)27-25-23(39)10-16(33)11-24(25)42-29(28(27)40)14-3-5-18(34)20(36)8-14/h3-11,27-29,31,33-41H,12H2,1-2H3/t27-,28-,29+,31+,32+/m0/s1 |
| InChI Key |
VWKAFYWVDIOMSL-PMFFMQSYSA-N |
| Purity |
95%+ |
| Appearance |
Reddish brown powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
284-511-6 |
| Isomeric SMILES |
CC1=CC(=C(C2=C1C[C@@]([C@H](O2)C3=CC(=C(C=C3)O)O)(C)O)[C@H]4[C@@H]([C@H](OC5=CC(=CC(=C45)O)O)C6=CC(=C(C=C6)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
