Hydroxocobalamin, food grade

Catalog	DS13422510
CAS	13422-51-0
Synonyms	Codroxomin; Hydrogrisevit; Idrogrisevit; Cobalex; Docclan
IUPAC Name	Cobalt(3+);[(2R,3S,4R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] [(2R)-1-[3-[(1R,2R,3R,4Z,7S,9Z,12S,13S,14Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl-2,7,12,17-tetrahydro-1H-corrin-21-id-3-yl]propanoylamino]propan-2-yl] phosphate;hydroxide
Molecular Weight	1346.4
Molecular Formula	C62H89CoN13O15P
InChI	InChI=1S/C62H90N13O14P.Co.H2O/c1-29-20-39-40(21-30(29)2)75(28-70-39)57-52(84)53(41(27-76)87-57)89-90(85,86)88-31(3)26-69-49(83)18-19-59(8)37(22-46(66)80)56-62(11)61(10,25-48(68)82)36(14-17-45(65)79)51(74-62)33(5)55-60(9,24-47(67)81)34(12-15-43(63)77)38(71-55)23-42-58(6,7)35(13-16-44(64)78)50(72-42)32(4)54(59)73-56;;/h20-21,23,28,31,34-37,41,52-53,56-57,76,84H,12-19,22,24-27H2,1-11H3,(H15,63,64,65,66,67,68,69,71,72,73,74,77,78,79,80,81,82,83,85,86);;1H2/q;+3;/p-3/t31-,34-,35-,36-,37+,41-,52-,53-,56-,57+,59-,60+,61+,62+;;/m1../s1
InChI Key	YOZNUFWCRFCGIH-WZHZPDAFSA-K
Melting Point	>300 °C
Purity	98%+
Solubility	Soluble in methanol
Appearance	Crimson crystals or crystalline powder
Storage	Store at 2-8 °C
EC Number	236-533-2
Isomeric SMILES	CC1=CC2=C(C=C1C)N(C=N2)[C@@H]3[C@@H]([C@@H]([C@H](O3)CO)OP(=O)([O-])O[C@H](C)CNC(=O)CC[C@@]\4([C@H]([C@@H]5[C@]6([C@@]([C@@H](C(=N6)/C(=C\7/[C@@]([C@@H](C(=N7)/C=C\8/C([C@@H](C(=N8)/C(=C4\[N-]5)/C)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)/C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[OH-].[Co+3]
Type	Vitamin B12

Custom Q&A

What is Hydroxocobalamin and how is it used in nutrition?

Hydroxocobalamin is a form of vitamin B12, which is crucial for the production of red blood cells and proper functioning of the nervous system. In nutrition, hydroxocobalamin is used to treat and prevent vitamin B12 deficiency, which can lead to anemia and neurological issues. It is often administered through injections, particularly for those who have trouble absorbing vitamin B12 from their diet.

Why might someone require food-grade Hydroxocobalamin?

Individuals may require food-grade Hydroxocobalamin if they cannot obtain sufficient vitamin B12 from dietary sources due to dietary restrictions or absorption issues. For example, strict vegetarians and vegans might seek out food-grade B12 supplements, as natural food sources of this vitamin are primarily found in animal products.

What are the benefits of utilizing food-grade Hydroxocobalamin supplements over other forms of vitamin B12?

Food-grade Hydroxocobalamin offers a bioavailable form of vitamin B12, which can be more efficiently utilized by the body. It is often preferred for its longer retention in the body compared to other forms like cyanocobalamin. Furthermore, hydroxocobalamin does not introduce extra cyanide ions, which is a consideration in specific therapeutic contexts.

Are there any potential side effects from taking Hydroxocobalamin as a dietary supplement?

While hydroxocobalamin is generally safe, some individuals may experience side effects such as redness at the injection site, mild diarrhea, or itching. Severe side effects are rare but may include allergic reactions. It is essential to consult with a healthcare professional before starting supplementation.

How does Hydroxocobalamin interact with other nutrients or medications when used as a supplement?

Hydroxocobalamin may interact with certain medications such as chloramphenicol and certain anticonvulsants, potentially affecting their efficacy. It is crucial to discuss all medications and supplements with a healthcare provider to prevent negative interactions. Additionally, taking it with other B vitamins can contribute to a synergistic effect that supports metabolic and neurological health.

Our products and services are for research use only and cannot be used for any clinical purposes.

Online Inquiry

* Name

Phone

* Email

* Quantity

mg g kg Service

* Services & Products of Interest Hydroxocobalamin, food grade (13422-51-0)

* Project Description

* Verification Code

Submit