| Catalog |
DS19685097 |
| CAS |
19685-09-7 |
| Structure |  |
| Synonyms |
(S)-10-Hydroxycamptothecin; Hydroxycamptothecin; 10-Hydroxycamptothecine; 10-Hydroxy Camptothecin; Hydroxycamptothecine; (S)-4-Ethyl-4,9-Dihydroxy-1H-Pyrano[3',4':6,7]Indolizino[1,2-B]Quinoline-3,14(4H,12H)-Dione |
| IUPAC Name |
(19S)-19-ethyl-7,19-dihydroxy-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2(11),3,5,7,9,15(20)-heptaene-14,18-dione |
| Molecular Weight |
364.35 |
| Molecular Formula |
C20H16N2O5 |
| InChI |
InChI=1S/C20H16N2O5/c1-2-20(26)14-7-16-17-11(5-10-6-12(23)3-4-15(10)21-17)8-22(16)18(24)13(14)9-27-19(20)25/h3-7,23,26H,2,8-9H2,1H3/t20-/m0/s1 |
| InChI Key |
HAWSQZCWOQZXHI-FQEVSTJZSA-N |
| Melting Point |
230-237 °C |
| Purity |
98%+ |
| Density |
1.60 g/cm3 |
| Solubility |
Insoluble in EtOH, H2O |
| Appearance |
Light yellow crystalline powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
805-668-4 |
| Isomeric SMILES |
CC[C@@]1(C2=C(COC1=O)C(=O)N3CC4=C(C3=C2)N=C5C=CC(=CC5=C4)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
