| Catalog |
DS5289747 |
| CAS |
5289-74-7 |
| Structure |  |
| Synonyms |
Crustecdysone; Ecdysterone; Beta-Ecdysone; Commisterone; Isoinokosterone; Viticosterone |
| IUPAC Name |
(2S,3R,5R,9R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| Molecular Weight |
480.64 |
| Molecular Formula |
C27H44O7 |
| InChI |
InChI=1S/C27H44O7/c1-23(2,32)9-8-22(31)26(5,33)21-7-11-27(34)16-12-18(28)17-13-19(29)20(30)14-24(17,3)15(16)6-10-25(21,27)4/h12,15,17,19-22,29-34H,6-11,13-14H2,1-5H3/t15-,17-,19+,20-,21-,22+,24+,25+,26+,27+/m0/s1 |
| InChI Key |
NKDFYOWSKOHCCO-YPVLXUMRSA-N |
| Melting Point |
242-244 °C |
| Density |
1.076 g/cm3 (rough estimate) |
| Solubility |
Soluble in alcohol |
| Appearance |
Light brown or white crystalline powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
811-097-1 |
| Isomeric SMILES |
C[C@]12CC[C@H]3C(=CC(=O)[C@H]4[C@@]3(C[C@@H]([C@@H](C4)O)O)C)[C@@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)O)O)O)O |
| Packaging |
25 kg |
| Specification |
50%, 60%, 90%, 95%, 98%, 99% |
Our products and services are for research use only and cannot be used for any clinical purposes.
