| Catalog |
DS480193 |
| CAS |
480-19-3 |
| Structure |  |
| Synonyms |
3-Methylquercetin; Isorhamnetol; Quercetin 3'-Methyl Ether |
| IUPAC Name |
3,5,7-Trihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one |
| Molecular Weight |
316.27 |
| Molecular Formula |
C16H12O7 |
| InChI |
InChI=1S/C16H12O7/c1-22-11-4-7(2-3-9(11)18)16-15(21)14(20)13-10(19)5-8(17)6-12(13)23-16/h2-6,17-19,21H,1H3 |
| InChI Key |
IZQSVPBOUDKVDZ-UHFFFAOYSA-N |
| Melting Point |
307 °C |
| Purity |
98%+ |
| Density |
1.634±0.06 g/cm3 |
| Appearance |
Light yellow to amber to dark green neat |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
207-545-5 |
| Isomeric SMILES |
COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
