L-Histidine Hydrochloride, food grade
L-Histidine Hydrochloride, food grade
Contact Us

Tel:

Fax:

Email:

Address:

L-Histidine Hydrochloride, food grade

Catalog DS1007427
CAS 1007-42-7
Structure
Synonyms (S)-2-Amino-3-(1H-Imidazol-4-Yl)Propanoic Acid Hydrochloride; Histidine Monohydrochloride
IUPAC Name (2S)-2-amino-3-(1H-imidazol-5-yl)propanoic acid;hydrochloride
Molecular Weight 191.62
Molecular Formula C6H9N3O2·HCl
InChI InChI=1S/C6H9N3O2.ClH/c7-5(6(10)11)1-4-2-8-3-9-4;/h2-3,5H,1,7H2,(H,8,9)(H,10,11);1H/t5-;/m0./s1
InChI Key QZNNVYOVQUKYSC-JEDNCBNOSA-N
Melting Point 240-245 °C
Purity 99%+
Solubility Soluble in water
Appearance White crystalline powder
Shelf Life 24 months
Storage Store in a tightly sealed container under an inert atmosphere. Keep in a cool dry place away from light.
EC Number 213-754-2
Isomeric SMILES C1=C(NC=N1)C[C@@H](C(=O)O)N.Cl
Packaging 25 kg
Standard USP, AJI
Custom Q&A

What is L-Histidine Hydrochloride, and why is it used in food supplements?

L-Histidine Hydrochloride is a crystalline amino acid compound that combines L-histidine with hydrochloride for improved stability and absorption. In food supplements, it is used due to its essential role in human metabolism, as it helps with tissue growth, repair, and the production of important molecules like hemoglobin and histamine.

What are the potential health benefits of L-Histidine Hydrochloride for the human body?

L-Histidine is known for its role in producing histamine, a critical compound for immune response, digestion, and neurological function. It also supports systemic functions such as detoxification, joint health, and protection against radiation damage due to its capacity to chelate heavy metals and act as an antioxidant.

How does L-Histidine Hydrochloride contribute to digestive health?

L-Histidine plays a significant part in the production of gastric juices, which are necessary for efficient digestion. It supports the breakdown of food in the stomach, promotes nutrient absorption, and maintains the stomach's proper function by contributing to the formation of histamine.

What is the recommended dosage of L-Histidine Hydrochloride, and are there any safety concerns?

The recommended dosage of L-Histidine Hydrochloride varies based on individual needs, generally ranging from 500 to 1500 mg per day for adults. While it is considered safe when taken within recommended limits, excessive intake can lead to imbalances with other amino acids and cause adverse effects such as headaches and fatigue.

Are there any populations that should be particularly mindful of their L-Histidine intake?

People with pre-existing health conditions such as kidney or liver impairment should monitor their intake due to their body's reduced ability to metabolize amino acids. Additionally, individuals with histamine intolerance or certain allergies may need to manage their L-histidine consumption carefully to avoid reactions.

In what foods can L-Histidine naturally be found, and how does this relate to its supplementation?

L-Histidine is naturally present in high-protein foods like meat, eggs, dairy products, nuts, and seeds. Supplementation with L-Histidine Hydrochloride can be particularly beneficial for vegetarians, vegans, or those with specific dietary restrictions that limit the intake of animal-based proteins, thus ensuring adequate levels of this essential amino acid.

What research backs the efficacy of L-Histidine Hydrochloride in promoting health?

Scientific studies indicate that L-Histidine supplementation might help manage conditions like rheumatoid arthritis by reducing inflammation and oxidative stress. Additionally, research suggests it may have roles in improving cognitive function, repairing tissues, and supporting overall metabolic health, though more studies are needed to confirm these effects universally.

Our products and services are for research use only and cannot be used for any clinical purposes.

Online Inquiry
Verification code