| Catalog |
DS2216515 |
| CAS |
2216-51-5 |
| Structure |  |
| Synonyms |
Levomenthol; Menthomenthol; L-(-)-Menthol; Menthacamphor; Peppermint Camphor |
| IUPAC Name |
(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| Molecular Weight |
156.27 |
| Molecular Formula |
C10H20O |
| InChI |
InChI=1S/C10H20O/c1-7(2)9-5-4-8(3)6-10(9)11/h7-11H,4-6H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChI Key |
NOOLISFMXDJSKH-KXUCPTDWSA-N |
| Melting Point |
41-45 °C |
| Density |
0.89 g/mL |
| Solubility |
Insoluble in water |
| Appearance |
Colorless to white crystals or crystalline needles |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container away from light |
| Certification |
ISO, Halal, Kosher |
| EC Number |
218-690-9 |
| Isomeric SMILES |
C[C@@H]1CC[C@H]([C@@H](C1)O)C(C)C |
Our products and services are for research use only and cannot be used for any clinical purposes.
