| Catalog |
DS151533221 |
| CAS |
151533-22-1 |
| Synonyms |
Calcium Levomefolate; Bodyfolin; Metafolin; Nutrifolin |
| IUPAC Name |
Calcium;(2S)-2-[[4-[[(6S)-2-amino-5-methyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl]methylamino]benzoyl]amino]pentanedioate |
| Molecular Weight |
497.5 |
| Molecular Formula |
C20H23CaN7O6 |
| InChI |
InChI=1S/C20H25N7O6.Ca/c1-27-12(9-23-16-15(27)18(31)26-20(21)25-16)8-22-11-4-2-10(3-5-11)17(30)24-13(19(32)33)6-7-14(28)29;/h2-5,12-13,22H,6-9H2,1H3,(H,24,30)(H,28,29)(H,32,33)(H4,21,23,25,26,31);/q;+2/p-2/t12-,13-;/m0./s1 |
| InChI Key |
VWBBRFHSPXRJQD-QNTKWALQSA-L |
| Melting Point |
>300 °C |
| Purity |
99%+ |
| Solubility |
Slightly soluble in water |
| Appearance |
Off-White to Light Yellow |
| Storage |
Store in a tightly sealed container under an inert atmosphere. Keep in a cool dry place away from light. |
| EC Number |
691-636-3 |
| Isomeric SMILES |
CN1[C@H](CNC2=C1C(=O)NC(=N2)N)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Ca+2] |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
