| Catalog |
DS1180718 |
| CAS |
1180-71-8 |
| Structure |  |
| Synonyms |
Limonoate D-Ring-Lactone; Limonoic Acid Di-Delta-Lactone |
| IUPAC Name |
(1R,2R,7S,10R,13R,14R,16S,19S,20S)-19-(furan-3-yl)-9,9,13,20-tetramethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,12,17-trione |
| Molecular Weight |
470.53 |
| Molecular Formula |
C26H30O8 |
| InChI |
InChI=1S/C26H30O8/c1-22(2)15-9-16(27)24(4)14(25(15)12-31-18(28)10-17(25)33-22)5-7-23(3)19(13-6-8-30-11-13)32-21(29)20-26(23,24)34-20/h6,8,11,14-15,17,19-20H,5,7,9-10,12H2,1-4H3/t14-,15-,17-,19-,20+,23-,24-,25+,26+/m0/s1 |
| InChI Key |
KBDSLGBFQAGHBE-MSGMIQHVSA-N |
| Melting Point |
298 °C |
| Density |
1.39±0.1 g/cm3 |
| Solubility |
Insoluble in water, easily soluble in methanol and ethanol |
| Appearance |
Yellow-brown or light yellow or white fine powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| Isomeric SMILES |
C[C@@]12CC[C@H]3[C@]([C@@]14[C@H](O4)C(=O)O[C@H]2C5=COC=C5)(C(=O)C[C@@H]6[C@@]37COC(=O)C[C@@H]7OC6(C)C)C |
| Packaging |
25 kg |
| Specification |
30%, 90%, 95%, 98% |
Our products and services are for research use only and cannot be used for any clinical purposes.
