| Catalog |
DS491703 |
| CAS |
491-70-3 |
| Structure |  |
| Synonyms |
Digitoflavone; Luteolol; 3',4',5,7-Tetrahydroxyflavone |
| IUPAC Name |
2-(3,4-Dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| Molecular Weight |
286.24 |
| Molecular Formula |
C15H10O6 |
| InChI |
InChI=1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H |
| InChI Key |
IQPNAANSBPBGFQ-UHFFFAOYSA-N |
| Melting Point |
328-330 °C |
| Purity |
98%+ |
| Density |
1.298 g/cm3 |
| Solubility |
Slightly soluble in water |
| Appearance |
Yellow needle crystal |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
207-741-0 |
| Isomeric SMILES |
C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
