| Catalog |
DS480411 |
| CAS |
480-41-1 |
| Structure |  |
| Synonyms |
4',5,7-Trihydroxyflavanone; Salipurol; (S)-5,7-Dihydroxy-2-(4-Hydroxyphenyl)Chroman-4-One |
| IUPAC Name |
(2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-2,3-dihydrochromen-4-one |
| Molecular Weight |
272.25 |
| Molecular Formula |
C15H12O5 |
| InChI |
InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)13-7-12(19)15-11(18)5-10(17)6-14(15)20-13/h1-6,13,16-18H,7H2/t13-/m0/s1 |
| InChI Key |
FTVWIRXFELQLPI-ZDUSSCGKSA-N |
| Melting Point |
247-250 °C |
| Purity |
98%+ |
| Density |
1.207 g/cm3 |
| Appearance |
Beige-brown powder |
| Shelf Life |
24 months |
| Storage |
Store at 2-8 ºC in a dry, airtight container away from light. Under an inert atmosphere. |
| EC Number |
207-550-2 |
| Isomeric SMILES |
C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC=C(C=C3)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
