| Catalog |
DS478013 |
| CAS |
478-01-3 |
| Structure |  |
| Synonyms |
Naringenine-7-Rhamnosidoglucoside |
| IUPAC Name |
2-(3,4-Dimethoxyphenyl)-5,6,7,8-tetramethoxychromen-4-one |
| Molecular Weight |
402.39 |
| Molecular Formula |
C21H22O8 |
| InChI |
InChI=1S/C21H22O8/c1-23-13-8-7-11(9-15(13)24-2)14-10-12(22)16-17(25-3)19(26-4)21(28-6)20(27-5)18(16)29-14/h7-10H,1-6H3 |
| InChI Key |
MRIAQLRQZPPODS-UHFFFAOYSA-N |
| Melting Point |
137-138 °C |
| Purity |
98%+ |
| Density |
1.244±0.06 g/cm3 |
| Solubility |
Slightly soluble in water |
| Appearance |
White powder |
| Shelf Life |
24 months |
| Storage |
Store at 2-8 ºC in a dry, airtight container away from light. Under an inert atmosphere. |
| Isomeric SMILES |
COC1=C(C=C(C=C1)C2=CC(=O)C3=C(O2)C(=C(C(=C3OC)OC)OC)OC)OC |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
