| Catalog |
DS484128 |
| CAS |
484-12-8 |
| Structure |  |
| Synonyms |
Ostol; Ostole; 7-Methoxy-8-(3-Methylbut-2-En-1-Yl)-2H-Chromen-2-One; 7-Methoxy-8-Isopentenylcoumarin; 7-Methoxy-8-(3-Methylbut-2-Enyl)Chromen-2-One |
| IUPAC Name |
7-Methoxy-8-(3-methylbut-2-enyl)chromen-2-one |
| Molecular Weight |
244.29 |
| Molecular Formula |
C15H16O3 |
| InChI |
InChI=1S/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3 |
| InChI Key |
MBRLOUHOWLUMFF-UHFFFAOYSA-N |
| Melting Point |
83-84 °C |
| Density |
1.126 g/cm3 |
| Solubility |
Soluble in ethanol, insoluble in water. |
| Appearance |
Yellow-green powder, or white needle crystal |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
610-421-7 |
| Isomeric SMILES |
CC(=CCC1=C(C=CC2=C1OC(=O)C=C2)OC)C |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
