| Catalog |
DS16837528 |
| CAS |
16837-52-8 |
| Structure |  |
| Synonyms |
Ammothamnine; Matrine N-Oxide; Oxysophoridine; Matrine Oxide; Oxymatrine,(S); Matrine 1beta-Oxide |
| IUPAC Name |
(1R,2R,9S,17S)-13-oxido-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| Molecular Weight |
264.36 |
| Molecular Formula |
C15H24N2O2 |
| InChI |
InChI=1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17?/m0/s1 |
| InChI Key |
XVPBINOPNYFXID-LHDUFFHYSA-N |
| Melting Point |
208 °C |
| Purity |
98% |
| Appearance |
White crystalline powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
605-514-4 |
| Isomeric SMILES |
C1C[C@@H]2[C@H]3CCC[N+]4([C@H]3[C@@H](CCC4)CN2C(=O)C1)[O-] |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
