| Catalog |
DS60822 |
| CAS |
60-82-2 |
| Structure |  |
| Synonyms |
Dihydronaringenin; 3-(4-Hydroxyphenyl)-1-(2,4,6-Trihydroxyphenyl)Propan-1-One; Phloretol; 3-(4-Hydroxyphenyl)-1-(2,4,6-Trihydroxyphenyl)-1-Propanone; 1-Propanone, 3-(4-Hydroxyphenyl)-1-(2,4,6-Trihydroxyphenyl)- |
| IUPAC Name |
3-(4-Hydroxyphenyl)-1-(2,4,6-trihydroxyphenyl)propan-1-one |
| Molecular Weight |
274.27 |
| Molecular Formula |
C15H14O5 |
| InChI |
InChI=1S/C15H14O5/c16-10-4-1-9(2-5-10)3-6-12(18)15-13(19)7-11(17)8-14(15)20/h1-2,4-5,7-8,16-17,19-20H,3,6H2 |
| InChI Key |
VGEREEWJJVICBM-UHFFFAOYSA-N |
| Melting Point |
-260 °C |
| Purity |
98%+ |
| Density |
1.183 g/cm3 |
| Solubility |
Slightly soluble in methanol, acetonitrile |
| Appearance |
White to beige power |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
200-488-7 |
| Isomeric SMILES |
C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O)O)O)O |
| Packaging |
20 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
