| Catalog |
DS65914172 |
| CAS |
65914-17-2 |
| Structure |  |
| Synonyms |
3,4'-5-Trihydroxystilbene-3-Beta-D-Glucopyranoside |
| IUPAC Name |
(2S,3R,4S,5S,6R)-2-[3-hydroxy-5-[(E)-2-(4-hydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight |
390.4 |
| Molecular Formula |
C20H22O8 |
| InChI |
InChI=1S/C20H22O8/c21-10-16-17(24)18(25)19(26)20(28-16)27-15-8-12(7-14(23)9-15)2-1-11-3-5-13(22)6-4-11/h1-9,16-26H,10H2/b2-1+/t16-,17-,18+,19-,20-/m1/s1 |
| InChI Key |
HSTZMXCBWJGKHG-CUYWLFDKSA-N |
| Melting Point |
223-226 °C |
| Density |
1.521±0.06 g/cm3 |
| Solubility |
Slightly soluble in methanol, DMSO, water |
| Appearance |
White needle crystal powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
200-001-8 |
| Isomeric SMILES |
C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
