| Catalog |
DS117395 |
| CAS |
117-39-5 |
| Synonyms |
Meletin; Sophoretin; Quercetine; Xanthaurine |
| IUPAC Name |
2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| Molecular Weight |
302 |
| Molecular Formula |
C15H10O7 |
| InChI |
InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
| InChI Key |
REFJWTPEDVJJIY-UHFFFAOYSA-N |
| Melting Point |
316.5 °C |
| Purity |
98%+ |
| Density |
1.362 g/cm3 |
| Solubility |
Insoluble in water |
| Appearance |
Yellow powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
204-187-1 |
| Isomeric SMILES |
C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
