| Catalog |
DS512696 |
| CAS |
512-69-6 |
| Structure |  |
| Synonyms |
D-Raffinose; Melitose; Melitriose; Gossypose; D-(+)-Raffinose; 6G-Alpha-D-Galactosylsucrose |
| IUPAC Name |
(2S,3R,4S,5R,6R)-2-[[(2R,3S,4S,5R,6R)-6-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Weight |
504.44 |
| Molecular Formula |
C18H32O16 |
| InChI |
InChI=1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1 |
| InChI Key |
MUPFEKGTMRGPLJ-ZQSKZDJDSA-N |
| Melting Point |
80 °C |
| Density |
1.465 g/cm3 |
| Solubility |
DMSO: 100 mg/mL |
| Appearance |
White crystal powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
208-146-9 |
| Isomeric SMILES |
C([C@@H]1[C@@H]([C@@H]([C@H]([C@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)O[C@]3([C@H]([C@@H]([C@H](O3)CO)O)O)CO)O)O)O)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
