| Catalog |
DS10338519 |
| CAS |
10338-51-9 |
| Synonyms |
Rhodioloside |
| IUPAC Name |
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-hydroxyphenyl)ethoxy]oxane-3,4,5-triol |
| Molecular Weight |
300.307 |
| Molecular Formula |
C14H20O7 |
| InChI |
InChI=1S/C14H20O7/c15-7-10-11(17)12(18)13(19)14(21-10)20-6-5-8-1-3-9(16)4-2-8/h1-4,10-19H,5-7H2/t10-,11-,12+,13-,14-/m1/s1 |
| InChI Key |
ILRCGYURZSFMEG-RKQHYHRCSA-N |
| Melting Point |
159-160 °C |
| Purity |
98%+ |
| Density |
1.46±0.1 g/cm3 |
| Solubility |
Slightly soluble in methanol, pyridine |
| Appearance |
Off-white |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
695-621-2 |
| Isomeric SMILES |
C1=CC(=CC=C1CCO[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
