| Catalog |
DS2447543. |
| CAS |
2447-54-3. |
| Structure |  |
| Synonyms |
Pseudochelerythrine; Sanguinarin; Sangvinarin; Veadent; SANGUINARIUM; Sangrovit |
| IUPAC Name |
24-methyl-5,7,18,20-tetraoxa-24-azoniahexacyclo[11.11.0.02,10.04,8.014,22.017,21]tetracosa-1(24),2,4(8),9,11,13,15,17(21),22-nonaene |
| Molecular Weight |
332.33 |
| Molecular Formula |
C20H14NO4 |
| InChI |
InChI=1S/C20H14NO4/c1-21-8-15-12(4-5-16-20(15)25-10-22-16)13-3-2-11-6-17-18(24-9-23-17)7-14(11)19(13)21/h2-8H,9-10H2,1H3/q+1 |
| InChI Key |
INVGWHRKADIJHF-UHFFFAOYSA-N |
| Melting Point |
277-280 °C |
| Purity |
98%+ |
| Density |
1.346ng/cm3 |
| Solubility |
Soluble in methanol and ethanol. |
| Appearance |
Pale yellow needle crystal |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
219-503-3 |
| Isomeric SMILES |
C[N+]1=C2C(=C3C=CC4=C(C3=C1)OCO4)C=CC5=CC6=C(C=C52)OCO6 |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
