| Catalog |
DS145572447 |
| CAS |
145572-44-7 |
| Synonyms |
13,14-Didehydromatridin-15-One; Sophocarpine Monohydrate; Sophoridine Hydrate |
| IUPAC Name |
(1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one |
| Molecular Weight |
246.3 |
| Molecular Formula |
C15H22N2O |
| InChI |
InChI=1S/C15H22N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h1,7,11-13,15H,2-6,8-10H2/t11-,12+,13+,15-/m0/s1 |
| InChI Key |
AAGFPTSOPGCENQ-JLNYLFASSA-N |
| Melting Point |
54-55 °C |
| Purity |
98%+ |
| Density |
1.19±0.1 g/cm3 |
| Solubility |
Soluble in acetone, dichloromethane |
| Appearance |
White powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| Isomeric SMILES |
C1C[C@H]2CN3[C@H](CC=CC3=O)[C@@H]4[C@H]2N(C1)CCC4 |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
