| Catalog |
DS6882684 |
| CAS |
6882-68-4 |
| Structure |  |
| Synonyms |
Sophoridin; 5-Epidihydrosophocarpine; Dihydro-5-Episophocarpine; (5-Beta)-Matridin-15-One; L-Sophoridine |
| IUPAC Name |
(1R,2R,9R,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadecan-6-one |
| Molecular Weight |
248.36 |
| Molecular Formula |
C15H24N2O |
| InChI |
InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12-,13-,15+/m1/s1 |
| InChI Key |
ZSBXGIUJOOQZMP-BHPKHCPMSA-N |
| Melting Point |
108-112 °C |
| Purity |
98%+ |
| Density |
1.16±0.1 g/cm3 |
| Solubility |
Soluble in water, ethanol |
| Appearance |
White or light yellow crystal |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
683-139-5 |
| Isomeric SMILES |
C1C[C@@H]2[C@H]3CCCN4[C@H]3[C@H](CCC4)CN2C(=O)C1 |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
