| Catalog |
DS568729 |
| CAS |
568-72-9 |
| Structure |  |
| Synonyms |
Dan Shen Ketone; Tanshinone II; Tanshinone B; Tanshinon II; 1,6,6-Trimethyl-6,7,8,9-Tetrahydrophenanthro[1,2-B]Furan-10,11-Dione |
| IUPAC Name |
1,6,6-Trimethyl-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-10,11-dione |
| Molecular Weight |
294.33 |
| Molecular Formula |
C19H18O3 |
| InChI |
InChI=1S/C19H18O3/c1-10-9-22-18-12-6-7-13-11(5-4-8-19(13,2)3)15(12)17(21)16(20)14(10)18/h6-7,9H,4-5,8H2,1-3H3 |
| InChI Key |
HYXITZLLTYIPOF-UHFFFAOYSA-N |
| Melting Point |
209-210 °C |
| Density |
1.209±0.06 g/cm3 |
| Solubility |
Soluble in ethanol, slightly soluble in water. |
| Appearance |
Orange red needle crystal |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| Isomeric SMILES |
CC1=COC2=C1C(=O)C(=O)C3=C2C=CC4=C3CCCC4(C)C |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
