| Catalog |
DS535831 |
| CAS |
535-83-1 |
| Structure |  |
| Synonyms |
N-Methylnicotinate; Caffearine |
| IUPAC Name |
1-Methylpyridin-1-ium-3-carboxylate |
| Molecular Weight |
137.14 |
| Molecular Formula |
C7H7NO2 |
| InChI |
InChI=1S/C7H7NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-5H,1H3 |
| InChI Key |
WWNNZCOKKKDOPX-UHFFFAOYSA-N |
| Melting Point |
260 °C |
| Purity |
95%+ |
| Density |
1.253 g/cm3 |
| Solubility |
Slightly soluble in methanol, water |
| Appearance |
Off-white to light beige |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
208-620-5 |
| Isomeric SMILES |
C[N+]1=CC=CC(=C1)C(=O)[O-] |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
