| Catalog |
DS7085554 |
| CAS |
7085-55-4 |
| Structure |  |
| Synonyms |
Posorutin; Troxerutine; Vitamin P4; Venoruton P4; Trihydroxyethylrutin |
| IUPAC Name |
2-[3,4-Bis(2-hydroxyethoxy)phenyl]-5-hydroxy-7-(2-hydroxyethoxy)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
| Molecular Weight |
742.675 |
| Molecular Formula |
C33H42O19 |
| InChI |
InChI=1S/C33H42O19/c1-14-23(38)26(41)28(43)32(49-14)48-13-21-24(39)27(42)29(44)33(51-21)52-31-25(40)22-17(37)11-16(45-7-4-34)12-20(22)50-30(31)15-2-3-18(46-8-5-35)19(10-15)47-9-6-36/h2-3,10-12,14,21,23-24,26-29,32-39,41-44H,4-9,13H2,1H3/t14-,21+,23-,24+,26+,27-,28+,29+,32+,33-/m0/s1 |
| InChI Key |
IYVFNTXFRYQLRP-VVSTWUKXSA-N |
| Melting Point |
181 °C |
| Purity |
98%+ |
| Density |
1.65 g/cm3 |
| Solubility |
Freely soluble in water, slightly soluble in ethanol (96 per cent) and practically insoluble in methylene chloride. |
| Appearance |
Light yellow powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
230-389-4 |
| Isomeric SMILES |
C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC3=C(OC4=CC(=CC(=C4C3=O)O)OCCO)C5=CC(=C(C=C5)OCCO)OCCO)O)O)O)O)O)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
