| Catalog |
DS125462 |
| CAS |
125-46-2 |
| Structure |  |
| Synonyms |
(+)-Usnic Acid; (+)-Usnein; (+)-Usniacin;D-2,6-Diacetyl-7,9-Dihydroxy-8,9B-Dimethyl-1,3(2H,9BH)- Dibenzofurandione |
| IUPAC Name |
2,6-Diacetyl-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| Molecular Weight |
344.32 |
| Molecular Formula |
C18H16O7 |
| InChI |
InChI=1S/C18H16O7/c1-6-14(22)12(8(3)20)16-13(15(6)23)18(4)10(25-16)5-9(21)11(7(2)19)17(18)24/h5,11,22-23H,1-4H3 |
| InChI Key |
CUCUKLJLRRAKFN-UHFFFAOYSA-N |
| Melting Point |
192-204 °C |
| Purity |
98%+ |
| Density |
1.287 g/cm3 |
| Appearance |
Yellow crystalline powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container under an inert atmosphere, away from light. |
| EC Number |
204-740-7 |
| Isomeric SMILES |
CC1=C(C(=C2C(=C1O)C3(C(=CC(=O)C(C3=O)C(=O)C)O2)C)C(=O)C)O |
| Packaging |
25 kg |
Our products and services are for research use only and cannot be used for any clinical purposes.
