| Catalog |
DS121335 |
| CAS |
121-33-5 |
| Structure |  |
| Synonyms |
Vanillaldehyde; Vanillic Aldehyde; P-Vanillin; Lioxin; Vanilla |
| IUPAC Name |
4-Hydroxy-3-methoxybenzaldehyde |
| Molecular Weight |
152.15 |
| Molecular Formula |
C8H8O3 |
| InChI |
InChI=1S/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 |
| InChI Key |
MWOOGOJBHIARFG-UHFFFAOYSA-N |
| Melting Point |
81-83 °C |
| Density |
1.06 g/cm3 |
| Solubility |
Methanol: 0.1 g/mL, clear |
| Appearance |
White to pale yellow crystalline powder |
| Shelf Life |
24 months |
| Storage |
Store in a dry, airtight container away from light |
| Certification |
Kosher, Hahal, BRC, ISO |
| EC Number |
204-465-2 |
| Isomeric SMILES |
COC1=C(C=CC(=C1)C=O)O |
Our products and services are for research use only and cannot be used for any clinical purposes.
