| Catalog |
DS4468024 |
| CAS |
4468-02-4 |
| Synonyms |
Zincum Gluconicum; Zincgluconate; Zinc D-Gluconate (1:2) |
| IUPAC Name |
Zinc;(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| Molecular Weight |
455.7 |
| Molecular Formula |
C12H22O14Zn |
| InChI |
InChI=1S/2C6H12O7.Zn/c2*7-1-2(8)3(9)4(10)5(11)6(12)13;/h2*2-5,7-11H,1H2,(H,12,13);/q;;+2/p-2/t2*2-,3-,4+,5-;/m11./s1 |
| InChI Key |
WHMDKBIGKVEYHS-IYEMJOQQSA-L |
| Melting Point |
172-175 °C |
| Purity |
97%+ |
| Solubility |
Soluble in water, practically insoluble in anhydrous ethanol and in methylene chloride. |
| Appearance |
White to almost white powder to crystal |
| Storage |
Store in a cool and dry place, away from light |
| Assay |
97.0%-102.0% |
| EC Number |
224-736-9 |
| Isomeric SMILES |
C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Zn+2] |
| Lead |
0.8 ppm maximum |
| Mineral Content |
Zn (as-is): 12.3%-14.6%; Zn (anhydrous): 13.9%-14.6% |
Our products and services are for research use only and cannot be used for any clinical purposes.
