Cobamamide, food grade

Catalog	DS13870901
CAS	13870-90-1
Synonyms	Coenzyme B12; Calomide; Adenosylcobalamin; Vitamin B12 Coenzyme; 5'-Deoxyadenosylcobalamine
IUPAC Name	(2S,3S,4R)-2-(6-aminopurin-9-yl)-5-methanidyloxolane-3,4-diol;cobalt(3+);[(2R,5S)-5-(5,6-dimethylbenzimidazol-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] 1-[3-[(2R,3R,4Z,7S,9Z,12S,13S,14Z,17S,18S,19R)-2,13,18-tris(2-amino-2-oxoethyl)-7,12,17-tris(3-amino-3-oxopropyl)-3,5,8,8,13,15,18,19-octamethyl-2,7,12,17-tetrahydro-1H-corrin-21-id-3-yl]propanoylamino]propan-2-yl phosphate
Molecular Weight	1579.6
Molecular Formula	C72H100CoN18O17P
InChI	InChI=1S/C62H90N13O14P.C10H12N5O3.Co/c1-29-20-39-40(21-30(29)2)75(28-70-39)57-52(84)53(41(27-76)87-57)89-90(85,86)88-31(3)26-69-49(83)18-19-59(8)37(22-46(66)80)56-62(11)61(10,25-48(68)82)36(14-17-45(65)79)51(74-62)33(5)55-60(9,24-47(67)81)34(12-15-43(63)77)38(71-55)23-42-58(6,7)35(13-16-44(64)78)50(72-42)32(4)54(59)73-56;1-4-6(16)7(17)10(18-4)15-3-14-5-8(11)12-2-13-9(5)15;/h20-21,23,28,31,34-37,41,52-53,56-57,76,84H,12-19,22,24-27H2,1-11H3,(H15,63,64,65,66,67,68,69,71,72,73,74,77,78,79,80,81,82,83,85,86);2-4,6-7,10,16-17H,1H2,(H2,11,12,13);/q;-1;+3/p-2/t31?,34-,35-,36-,37+,41-,52?,53?,56?,57+,59-,60+,61+,62+;4?,6-,7-,10-;/m10./s1
InChI Key	OAJLVMGLJZXSGX-VCABRDNDSA-L
Purity	98%+
Solubility	Easily soluble in water, insoluble in ethanol. Hardly soluble in acetone, ether and chloroform
Appearance	Crimson crystals or crystalline powder
Storage	Store at -20 °C
EC Number	237-627-6
Isomeric SMILES	CC1=CC2=C(C=C1C)N(C=N2)[C@@H]3C(C([C@H](O3)CO)OP(=O)([O-])OC(C)CNC(=O)CC[C@@]\4([C@H](C5[C@]6([C@@]([C@@H](C(=N6)/C(=C\7/[C@@]([C@@H](C(=N7)/C=C\8/C([C@@H](C(=N8)/C(=C4\[N-]5)/C)CCC(=O)N)(C)C)CCC(=O)N)(C)CC(=O)N)/C)CCC(=O)N)(C)CC(=O)N)C)CC(=O)N)C)O.[CH2-]C1[C@@H]([C@@H]([C@H](O1)N2C=NC3=C(N=CN=C32)N)O)O.[Co+3]
Type	Vitamin B12

Custom Q&A

What is cobamamide, and what role does it play in the body?

Cobamamide is a form of vitamin B12, also known as adenosylcobalamin, which acts as a coenzyme in various metabolic processes. It plays a crucial role in energy metabolism as it assists in the conversion of fats and proteins into energy, and it's essential for the formation of red blood cells and the maintenance of the nervous system.

What distinguishes cobamamide from other forms of vitamin B12?

Cobamamide, or adenosylcobalamin, is one of the two active coenzyme forms of vitamin B12; the other is methylcobalamin. Unlike other forms such as cyanocobalamin, which must be converted in the body to an active form, cobamamide is already in its active state. This makes it readily usable by the body for immediate biological functions.

Why might someone choose food-grade cobamamide over synthetic supplements?

Food-grade cobamamide is derived from natural sources and is often preferred by those seeking a more natural form of supplementation. It's easily absorbed by the body compared to synthetic forms, which may contain fillers or additives. Individuals with dietary restrictions or preferences for organic products may find food-grade supplements more suitable.

How does cobamamide support energy levels and overall health?

As a coenzyme in energy production, cobamamide supports mitochondrial function, helping in the breakdown of carbohydrates and fatty acids into energy. It also contributes to the synthesis of neurotransmitters and aids in DNA synthesis, which is vital for cell replication and overall cellular health. This support can result in increased energy levels and improved cognitive functions.

Are there specific populations that might benefit more from cobamamide supplementation?

Certain populations, such as those with pernicious anemia, vegans, older adults, and individuals with malabsorption issues, might benefit significantly from cobamamide supplementation. These groups might have a higher risk of vitamin B12 deficiency due to dietary restrictions or reduced absorption efficiency.

What dietary sources are rich in cobamamide, and how can individuals ensure adequate intake?

While cobamamide itself isn't found in foods as an isolated compound, foods rich in vitamin B12 can help maintain adequate levels. These include meat, fish, dairy products, and fortified plant-based milks or cereals. To ensure adequate intake, individuals should consume a balanced diet with these foods or consider supplementation, especially if dietary intake is insufficient.

How does the bioavailability of cobamamide compare to other vitamin B12 supplements?

Cobamamide has the advantage of being an active form of vitamin B12, which enhances its bioavailability. It doesn't require conversion by the body, leading to potentially more efficient absorption and utilization compared to other non-active forms like cyanocobalamin, which need to be converted to methylcobalamin or adenosylcobalamin within the body.

Can cobamamide supplementation have any adverse effects or interactions?

Generally, cobamamide supplementation is considered safe when taken within recommended doses. However, excessive intake can lead to potential side effects such as diarrhea, headaches, or hypersensitivity reactions. Individuals should consult with healthcare professionals before starting supplementation, especially if taking medications or having underlying health conditions that could interact with vitamin B12 metabolism.

Our products and services are for research use only and cannot be used for any clinical purposes.

Online Inquiry

* Name

Phone

* Email

* Quantity

mg g kg Service

* Services & Products of Interest Cobamamide, food grade (13870-90-1)

* Project Description

* Verification Code

Submit