- Home
- Ingredients
- Functional Ingredients
- Vitamins
- Vitamin B
- Provitamin B5, food grade
Catalog | DS81130 |
CAS | 81-13-0 |
Structure | ![]() |
Synonyms | Pantothenol; Ilopan; D-Pantothenyl Alcohol; Bepanthen; Bepanthene |
IUPAC Name | (2R)-2,4-dihydroxy-N-(3-hydroxypropyl)-3,3-dimethylbutanamide |
Molecular Weight | 205.25 |
Molecular Formula | C9H19NO4 |
InChI | InChI=1S/C9H19NO4/c1-9(2,6-12)7(13)8(14)10-4-3-5-11/h7,11-13H,3-6H2,1-2H3,(H,10,14)/t7-/m0/s1 |
InChI Key | SNPLKNRPJHDVJA-ZETCQYMHSA-N |
Melting Point | 64-69 °C |
Purity | 98%+ |
Solubility | Soluble in water, methanol, ethanol, propylene glycol, insoluble in oil and fat |
Appearance | Colorless to light yellow viscous liquid |
Shelf Life | 24 months |
Storage | Store in a cool and dry place, away from light |
EC Number | 201-327-3 |
Isomeric SMILES | CC(C)(CO)[C@H](C(=O)NCCCO)O |
Packaging | 25 kg |
Standard | USP, BP, EP, JP |
Type | Vitamin B5 |
What is Provitamin B5 and how is it commonly used in nutrition and health products?
Provitamin B5, also known as panthenol, is a precursor to vitamin B5 (pantothenic acid). In nutrition and health products, it is commonly used due to its ability to be converted into vitamin B5, which is essential for synthesizing coenzyme A, a molecule critical in fatty acid metabolism and the Krebs cycle for energy production.
How does Provitamin B5 benefit the human body when included in dietary supplements or food products?
When included in dietary supplements or food products, Provitamin B5 provides several benefits such as enhancing skin hydration, improving wound healing, and possibly reducing cholesterol levels. It plays a crucial role in metabolizing carbohydrates, proteins, and fats and is vital for maintaining healthy digestion and developing antibodies.
What are the safety considerations for the consumption of food-grade Provitamin B5?
Food-grade Provitamin B5 is generally recognized as safe for consumption. However, it is important to adhere to the recommended dietary allowances for vitamin B5 to avoid any potential side effects, such as gastrointestinal discomfort. Excessive supplementation beyond the typical dietary needs might lead to mild adverse symptoms, but significant toxicity is rare.
What are the potential applications of Provitamin B5 in the food and nutrition industry beyond supplementation?
Beyond supplementation, Provitamin B5 can be used in the food industry as a nutritional fortifier in various products, enhancing the nutritional content of foods. It can also be used in functional foods and beverages designed to provide specific health benefits, such as energy bars and sports drinks, due to its role in energy metabolism.
How does Provitamin B5 contribute to skincare when used in cosmetic products?
In cosmetic products, Provitamin B5 is valued for its moisturizing properties and ability to improve skin barrier function. It helps retain moisture deep in the skin layers, reducing hydration loss and improving skin elasticity and smoothness. Additionally, it has been shown to alleviate symptoms of dry skin and enhance wound healing and scar reduction.
Our products and services are for research use only and cannot be used for any clinical purposes.