- Home
- Ingredients
- Functional Ingredients
- Vitamins
- Vitamin B
- (R)-Pantothenic Acid, food grade
Catalog | DS79834 |
CAS | 79-83-4 |
Structure | ![]() |
Synonyms | Pantothenic Acid; D-Pantothenic Acid; Vitamin B5; Pantothenate; Chick Antidermatitis Factor; (R)-Pantothenate; (+)-Pantothenic Acid |
IUPAC Name | 3-[[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]amino]propanoic acid |
Molecular Weight | 219.23 |
Molecular Formula | C9H17NO5 |
InChI | InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/t7-/m0/s1 |
InChI Key | GHOKWGTUZJEAQD-ZETCQYMHSA-N |
Melting Point | 178-179 °C |
Purity | 99%+ |
Appearance | White powder |
Shelf Life | 24 months |
Storage | Store in a cool and dry place, away from light |
Certification | KOSHER/GMP/MUL/HALAL/ |
EC Number | 201-229-0 |
Isomeric SMILES | CC(C)(CO)[C@H](C(=O)NCCC(=O)O)O |
Packaging | 25 kg |
Standard | FCC, USP, EP |
Type | Vitamin B5 |
What is (R)-Pantothenic Acid and how does it differ from regular pantothenic acid?
(R)-Pantothenic Acid is a stereoisomer of pantothenic acid, also known as Vitamin B5. Pantothenic acid is vital for synthesizing coenzyme-A (CoA), which is essential for fatty acid metabolism and energy production. The "(R)" prefix indicates the specific rotational direction of the molecule, referring to its chirality, which can affect its biological activity and absorption.
What are the main dietary sources of pantothenic acid, and how can they benefit health?
Pantothenic acid is found in various foods, including eggs, meat, fish, avocados, and whole grains. Consuming these foods helps maintain healthy energy levels, support adrenal function, and facilitate the synthesis of proteins, fats, and carbohydrates.
Are there any significant health benefits associated with the intake of food-grade (R)-Pantothenic Acid?
Food-grade (R)-Pantothenic Acid is used to ensure purity and safety in dietary supplements and food products. Its potential benefits include improved energy metabolism, enhanced production of red blood cells, and better skin health due to its role in synthesizing coenzyme-A and maintaining cellular energy balance.
Could taking (R)-Pantothenic Acid have any known side effects or interactions with other nutrients?
Pantothenic acid is considered safe and well-tolerated, with no established toxicity level. However, excessive intake may lead to mild digestive upset or diarrhea. It is important to maintain a balanced intake of all B vitamins, as they work synergistically within the body.
How does the body utilize (R)-Pantothenic Acid in metabolic processes?
The body converts (R)-Pantothenic Acid into coenzyme-A, a crucial cofactor in various biochemical reactions that break down carbohydrates, fats, and proteins to produce energy. Furthermore, it is involved in synthesizing and metabolizing hormones, neurotransmitters, and hemoglobin.
Our products and services are for research use only and cannot be used for any clinical purposes.